C23H40O6 — CID 58363792
(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2-(butanoyloxymethyl)-2,4-dimethyl-3-oxopentanoate (PubChem CID 58363792) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2-(butanoyloxymethyl)-2,4-dimethyl-3-oxopentanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2-(butanoyloxymethyl)-2,4-dimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 58363792 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2-(butanoyloxymethyl)-2,4-dimethyl-3-oxopentanoate |
| SMILES | CCCC(=O)OCC(C)(C(=O)OCOC1CC(C)CCC1C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C23H40O6/c1-8-9-20(24)27-13-23(7,21(25)16(4)5)22(26)29-14-28-19-12-17(6)10-11-18(19)15(2)3/h15-19H,8-14H2,1-7H3 |
| InChIKey | MTUIBVFMCHGMNE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|