C17H32O3 — CID 58937638
(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2,2-dimethylbutanoate (PubChem CID 58937638) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2,2-dimethylbutanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58937638 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl)oxymethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCOC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C17H32O3/c1-7-17(5,6)16(18)20-11-19-15-10-13(4)8-9-14(15)12(2)3/h12-15H,7-11H2,1-6H3 |
| InChIKey | ZYIUCQXPBOGNTG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|