C18H26O4 — CID 69438928
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl 4-hydroxybenzoate (PubChem CID 69438928) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl 4-hydroxybenzoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 69438928 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl 4-hydroxybenzoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H26O4/c1-12(2)16-9-4-13(3)10-17(16)21-11-22-18(20)14-5-7-15(19)8-6-14/h5-8,12-13,16-17,19H,4,9-11H2,1-3H3/t13-,16+,17-/m1/s1 |
| InChIKey | YXDINQPDHRSJCL-XOKHGSTOSA-N |
| XLogP | 3.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|