C7H12OS2 — CID 58364445
1-(1,3-dithian-5-yl)propan-1-one (PubChem CID 58364445) has the molecular formula C7H12OS2 and a molecular weight of 176.31 g/mol. Its IUPAC name is 1-(1,3-dithian-5-yl)propan-1-one.
| Compound Name | 1-(1,3-dithian-5-yl)propan-1-one |
|---|---|
| PubChem CID | 58364445 |
| Molecular Formula | C7H12OS2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 1-(1,3-dithian-5-yl)propan-1-one |
| SMILES | CCC(=O)C1CSCSC1 |
| InChI | InChI=1S/C7H12OS2/c1-2-7(8)6-3-9-5-10-4-6/h6H,2-5H2,1H3 |
| InChIKey | DYUNLUPYYFVSOL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |