C27H27NO5S — CID 58365495
2-[2-(ethoxymethoxy)phenyl]-4-hydroxy-3-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)-2H-pyrrol-5-one (PubChem CID 58365495) has the molecular formula C27H27NO5S and a molecular weight of 477.58 g/mol. Its IUPAC name is 2-[2-(ethoxymethoxy)phenyl]-4-hydroxy-3-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)-2H-pyrrol-5-one.
| Compound Name | 2-[2-(ethoxymethoxy)phenyl]-4-hydroxy-3-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 58365495 |
| Molecular Formula | C27H27NO5S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-[2-(ethoxymethoxy)phenyl]-4-hydroxy-3-(2-methylpropanoyl)-1-(4-thiophen-3-ylphenyl)-2H-pyrrol-5-one |
| SMILES | CCOCOc1ccccc1C1C(C(=O)C(C)C)=C(O)C(=O)N1c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C27H27NO5S/c1-4-32-16-33-22-8-6-5-7-21(22)24-23(25(29)17(2)3)26(30)27(31)28(24)20-11-9-18(10-12-20)19-13-14-34-15-19/h5-15,17,24,30H,4,16H2,1-3H3 |
| InChIKey | WXOJZVOJKVHMLN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|