C11H16FN3O2 — CID 58367398
tert-butyl N-[(1S)-1-(5-fluoropyrimidin-2-yl)ethyl]carbamate (PubChem CID 58367398) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(5-fluoropyrimidin-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(5-fluoropyrimidin-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 58367398 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | tert-butyl N-[(1S)-1-(5-fluoropyrimidin-2-yl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ncc(F)cn1 |
| InChI | InChI=1S/C11H16FN3O2/c1-7(9-13-5-8(12)6-14-9)15-10(16)17-11(2,3)4/h5-7H,1-4H3,(H,15,16)/t7-/m0/s1 |
| InChIKey | HNXHBDFOMABPAW-ZETCQYMHSA-N |
| XLogP | 2.20 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |