C31H38N6O5 — CID 58371820
(2S)-2-[[[2-methoxy-5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 58371820) has the molecular formula C31H38N6O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is (2S)-2-[[[2-methoxy-5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | (2S)-2-[[[2-methoxy-5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 58371820 |
| Molecular Formula | C31H38N6O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | (2S)-2-[[[2-methoxy-5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | COc1nc(NC[C@H](CC(=O)OCc2ccccc2)C(=O)O)c(C)c(N2CCC(c3ccc4c(n3)NCCC4)CC2)n1 |
| InChI | InChI=1S/C31H38N6O5/c1-20-27(33-18-24(30(39)40)17-26(38)42-19-21-7-4-3-5-8-21)35-31(41-2)36-29(20)37-15-12-22(13-16-37)25-11-10-23-9-6-14-32-28(23)34-25/h3-5,7-8,10-11,22,24H,6,9,12-19H2,1-2H3,(H,32,34)(H,39,40)(H,33,35,36)/t24-/m0/s1 |
| InChIKey | AXYWUSRRNIFJPU-DEOSSOPVSA-N |
| XLogP | 4.18 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |