C35H48N6O2 — CID 58149599
tert-butyl (2S)-2-[[[5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-6-phenylhexanoate (PubChem CID 58149599) has the molecular formula C35H48N6O2 and a molecular weight of 584.81 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-6-phenylhexanoate.
| Compound Name | tert-butyl (2S)-2-[[[5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-6-phenylhexanoate |
|---|---|
| PubChem CID | 58149599 |
| Molecular Formula | C35H48N6O2 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.38 |
| IUPAC Name | tert-butyl (2S)-2-[[[5-methyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-6-phenylhexanoate |
| SMILES | Cc1c(NC[C@H](CCCCc2ccccc2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C35H48N6O2/c1-25-31(37-23-29(34(42)43-35(2,3)4)14-9-8-13-26-11-6-5-7-12-26)38-24-39-33(25)41-21-18-27(19-22-41)30-17-16-28-15-10-20-36-32(28)40-30/h5-7,11-12,16-17,24,27,29H,8-10,13-15,18-23H2,1-4H3,(H,36,40)(H,37,38,39)/t29-/m0/s1 |
| InChIKey | MHSQWFGASWDZLH-LJAQVGFWSA-N |
| XLogP | 6.70 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|