C35H49N7O2 — CID 59550774
tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-phenylpropylamino)propanoate (PubChem CID 59550774) has the molecular formula C35H49N7O2 and a molecular weight of 599.82 g/mol. Its IUPAC name is tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-phenylpropylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-phenylpropylamino)propanoate |
|---|---|
| PubChem CID | 59550774 |
| Molecular Formula | C35H49N7O2 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.39 |
| IUPAC Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(3-phenylpropylamino)propanoate |
| SMILES | CCc1c(NC[C@H](NCCCc2ccccc2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C35H49N7O2/c1-5-28-32(38-23-30(34(43)44-35(2,3)4)36-19-9-13-25-11-7-6-8-12-25)39-24-40-33(28)42-21-17-26(18-22-42)29-16-15-27-14-10-20-37-31(27)41-29/h6-8,11-12,15-16,24,26,30,36H,5,9-10,13-14,17-23H2,1-4H3,(H,37,41)(H,38,39,40)/t30-/m0/s1 |
| InChIKey | QITAABUZXKYIFH-PMERELPUSA-N |
| XLogP | 5.52 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|