C34H51N7O3 — CID 59593239
tert-butyl (2S)-2-(3-cyclopentylpropanoylamino)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate (PubChem CID 59593239) has the molecular formula C34H51N7O3 and a molecular weight of 605.83 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3-cyclopentylpropanoylamino)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-(3-cyclopentylpropanoylamino)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 59593239 |
| Molecular Formula | C34H51N7O3 |
| Molecular Weight | 605.83 g/mol |
| Exact Mass | 605.41 |
| IUPAC Name | tert-butyl (2S)-2-(3-cyclopentylpropanoylamino)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate |
| SMILES | CCc1c(NC[C@H](NC(=O)CCC2CCCC2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C34H51N7O3/c1-5-26-31(36-21-28(33(43)44-34(2,3)4)39-29(42)15-12-23-9-6-7-10-23)37-22-38-32(26)41-19-16-24(17-20-41)27-14-13-25-11-8-18-35-30(25)40-27/h13-14,22-24,28H,5-12,15-21H2,1-4H3,(H,35,40)(H,39,42)(H,36,37,38)/t28-/m0/s1 |
| InChIKey | XDORZGQZPWWKKK-NDEPHWFRSA-N |
| XLogP | 5.38 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.83 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |