C35H53N7O4 — CID 59593206
tert-butyl (2S)-2-(2-cyclohexylethoxycarbonylamino)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate (PubChem CID 59593206) has the molecular formula C35H53N7O4 and a molecular weight of 635.85 g/mol. Its IUPAC name is tert-butyl (2S)-2-(2-cyclohexylethoxycarbonylamino)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-(2-cyclohexylethoxycarbonylamino)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 59593206 |
| Molecular Formula | C35H53N7O4 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.42 |
| IUPAC Name | tert-butyl (2S)-2-(2-cyclohexylethoxycarbonylamino)-3-[[2,5-dimethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]propanoate |
| SMILES | Cc1nc(NC[C@H](NC(=O)OCCC2CCCCC2)C(=O)OC(C)(C)C)c(C)c(N2CCC(c3ccc4c(n3)NCCC4)CC2)n1 |
| InChI | InChI=1S/C35H53N7O4/c1-23-30(37-22-29(33(43)46-35(3,4)5)41-34(44)45-21-17-25-10-7-6-8-11-25)38-24(2)39-32(23)42-19-15-26(16-20-42)28-14-13-27-12-9-18-36-31(27)40-28/h13-14,25-26,29H,6-12,15-22H2,1-5H3,(H,36,40)(H,41,44)(H,37,38,39)/t29-/m0/s1 |
| InChIKey | YUHNYWITOJLCIF-LJAQVGFWSA-N |
| XLogP | 6.05 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |