C32H43Cl2N7O4 — CID 131727600
ethyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate;dihydrochloride (PubChem CID 131727600) has the molecular formula C32H43Cl2N7O4 and a molecular weight of 660.65 g/mol. Its IUPAC name is ethyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate;dihydrochloride.
| Compound Name | ethyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 131727600 |
| Molecular Formula | C32H43Cl2N7O4 |
| Molecular Weight | 660.65 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | ethyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate;dihydrochloride |
| SMILES | CCOC(=O)[C@H](CNc1ncnc(N2CCC(c3ccc4c(n3)NCCC4)CC2)c1CC)NC(=O)OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C32H41N7O4.2ClH/c1-3-25-29(34-19-27(31(40)42-4-2)38-32(41)43-20-22-9-6-5-7-10-22)35-21-36-30(25)39-17-14-23(15-18-39)26-13-12-24-11-8-16-33-28(24)37-26;;/h5-7,9-10,12-13,21,23,27H,3-4,8,11,14-20H2,1-2H3,(H,33,37)(H,38,41)(H,34,35,36);2*1H/t27-;;/m0../s1 |
| InChIKey | XVMBSGGUBPMQQU-LPCSYZHESA-N |
| XLogP | 5.29 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |