C34H45N7O3 — CID 59593215
tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(2-phenylacetyl)amino]propanoate (PubChem CID 59593215) has the molecular formula C34H45N7O3 and a molecular weight of 599.78 g/mol. Its IUPAC name is tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(2-phenylacetyl)amino]propanoate.
| Compound Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(2-phenylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 59593215 |
| Molecular Formula | C34H45N7O3 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.36 |
| IUPAC Name | tert-butyl (2S)-3-[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]-2-[(2-phenylacetyl)amino]propanoate |
| SMILES | CCc1c(NC[C@H](NC(=O)Cc2ccccc2)C(=O)OC(C)(C)C)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C34H45N7O3/c1-5-26-31(36-21-28(33(43)44-34(2,3)4)39-29(42)20-23-10-7-6-8-11-23)37-22-38-32(26)41-18-15-24(16-19-41)27-14-13-25-12-9-17-35-30(25)40-27/h6-8,10-11,13-14,22,24,28H,5,9,12,15-21H2,1-4H3,(H,35,40)(H,39,42)(H,36,37,38)/t28-/m0/s1 |
| InChIKey | CWQZGXLVZISHSJ-NDEPHWFRSA-N |
| XLogP | 4.66 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |