C28H36N6O2S — CID 58149657
(2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-thiophen-3-ylbutanoic acid (PubChem CID 58149657) has the molecular formula C28H36N6O2S and a molecular weight of 520.70 g/mol. Its IUPAC name is (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-thiophen-3-ylbutanoic acid.
| Compound Name | (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-thiophen-3-ylbutanoic acid |
|---|---|
| PubChem CID | 58149657 |
| Molecular Formula | C28H36N6O2S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (2S)-2-[[[5-ethyl-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrimidin-4-yl]amino]methyl]-4-thiophen-3-ylbutanoic acid |
| SMILES | CCc1c(NC[C@H](CCc2ccsc2)C(=O)O)ncnc1N1CCC(c2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C28H36N6O2S/c1-2-23-26(30-16-22(28(35)36)6-5-19-11-15-37-17-19)31-18-32-27(23)34-13-9-20(10-14-34)24-8-7-21-4-3-12-29-25(21)33-24/h7-8,11,15,17-18,20,22H,2-6,9-10,12-14,16H2,1H3,(H,29,33)(H,35,36)(H,30,31,32)/t22-/m0/s1 |
| InChIKey | XHCXWAJOEQRYAI-QFIPXVFZSA-N |
| XLogP | 4.98 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |