C16H27N5O2S — CID 58375363
6-methylsulfonyl-N-(3-piperidin-4-ylpropyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine (PubChem CID 58375363) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is 6-methylsulfonyl-N-(3-piperidin-4-ylpropyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | 6-methylsulfonyl-N-(3-piperidin-4-ylpropyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58375363 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 6-methylsulfonyl-N-(3-piperidin-4-ylpropyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCc2nc(NCCCC3CCNCC3)ncc2C1 |
| InChI | InChI=1S/C16H27N5O2S/c1-24(22,23)21-10-6-15-14(12-21)11-19-16(20-15)18-7-2-3-13-4-8-17-9-5-13/h11,13,17H,2-10,12H2,1H3,(H,18,19,20) |
| InChIKey | GGUINWZKHKLSRO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|