About 2-(2-aminophenyl)acetic acid
2-(2-aminophenyl)acetic acid (PubChem CID 583776) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-(2-aminophenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)acetic acid |
| PubChem CID | 583776 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2-(2-aminophenyl)acetic acid |
| SMILES | Nc1ccccc1CC(=O)O |
| InChI | InChI=1S/C8H9NO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5,9H2,(H,10,11) |
| InChIKey | KHMNCHDUSFCTGK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)acetic acid?
The IUPAC name of 2-(2-aminophenyl)acetic acid (CID 583776) is 2-(2-aminophenyl)acetic acid.
What is the SMILES notation for 2-(2-aminophenyl)acetic acid?
The canonical SMILES for 2-(2-aminophenyl)acetic acid is Nc1ccccc1CC(=O)O.
What is the InChIKey of 2-(2-aminophenyl)acetic acid?
The InChIKey is KHMNCHDUSFCTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5,9H2,(H,10,11).
What are the key properties of 2-(2-aminophenyl)acetic acid?
2-(2-aminophenyl)acetic acid has a molecular weight of 151.16 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)acetic acid is sourced from PubChem (CID 583776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).