3-aminobenzoic acid

C7H7NO2 — CID 7419

IUPAC3-aminobenzoic acid
SMILESNc1cccc(C(=O)O)c1
InChIInChI=1S/C7H7NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H,9,10)
InChIKeyXFDUHJPVQKIXHO-UHFFFAOYSA-N
MW137.14 g/mol
LogP0.97
Rot. Bonds1

About 3-aminobenzoic acid

3-aminobenzoic acid (PubChem CID 7419) has the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. Its IUPAC name is 3-aminobenzoic acid.

Molecular Properties

Compound Name3-aminobenzoic acid
PubChem CID7419
Molecular FormulaC7H7NO2
Molecular Weight137.14 g/mol
Exact Mass137.05
IUPAC Name3-aminobenzoic acid
SMILESNc1cccc(C(=O)O)c1
InChIInChI=1S/C7H7NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H,9,10)
InChIKeyXFDUHJPVQKIXHO-UHFFFAOYSA-N
XLogP0.97
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.14
LogP ≤ 50.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3-aminobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-aminobenzoic acid?
The IUPAC name of 3-aminobenzoic acid (CID 7419) is 3-aminobenzoic acid.
What is the SMILES notation for 3-aminobenzoic acid?
The canonical SMILES for 3-aminobenzoic acid is Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-aminobenzoic acid?
The InChIKey is XFDUHJPVQKIXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H,9,10).
What are the key properties of 3-aminobenzoic acid?
3-aminobenzoic acid has a molecular weight of 137.14 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzoic acid is sourced from PubChem (CID 7419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).