C10H19N2+ — CID 58381737
1-(2-methylprop-2-enyl)-4-aza-1-azoniabicyclo[2.2.2]octane (PubChem CID 58381737) has the molecular formula C10H19N2+ and a molecular weight of 167.28 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-4-aza-1-azoniabicyclo[2.2.2]octane.
| Compound Name | 1-(2-methylprop-2-enyl)-4-aza-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 58381737 |
| Molecular Formula | C10H19N2+ |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-4-aza-1-azoniabicyclo[2.2.2]octane |
| SMILES | C=C(C)C[N+]12CCN(CC1)CC2 |
| InChI | InChI=1S/C10H19N2/c1-10(2)9-12-6-3-11(4-7-12)5-8-12/h1,3-9H2,2H3/q+1 |
| InChIKey | SQGQBCQIGJZFJZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|