C18H18BrF7N2O — CID 139176901
1-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)methyl]-4-aza-1-azoniabicyclo[2.2.2]octane;methanol;bromide (PubChem CID 139176901) has the molecular formula C18H18BrF7N2O and a molecular weight of 491.25 g/mol. Its IUPAC name is 1-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)methyl]-4-aza-1-azoniabicyclo[2.2.2]octane;methanol;bromide.
| Compound Name | 1-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)methyl]-4-aza-1-azoniabicyclo[2.2.2]octane;methanol;bromide |
|---|---|
| PubChem CID | 139176901 |
| Molecular Formula | C18H18BrF7N2O |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 1-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)methyl]-4-aza-1-azoniabicyclo[2.2.2]octane;methanol;bromide |
| SMILES | CO.Fc1c(F)c(F)c2c(F)c(C[N+]34CCN(CC3)CC4)c(F)c(F)c2c1F.[Br-] |
| InChI | InChI=1S/C17H14F7N2.CH4O.BrH/c18-11-8(7-26-4-1-25(2-5-26)3-6-26)12(19)13(20)10-9(11)14(21)16(23)17(24)15(10)22;1-2;/h1-7H2;2H,1H3;1H/q+1;;/p-1 |
| InChIKey | UCCTWNNUJIBOEO-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|