C21H24N6O — CID 58382252
N-[2-(dimethylamino)ethyl]-2-[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]acetamide (PubChem CID 58382252) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 58382252 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]acetamide |
| SMILES | CN(C)CCNC(=O)Cc1cccc(-c2cc3c(ncc4c[nH]n(C)c43)n2)c1 |
| InChI | InChI=1S/C21H24N6O/c1-26(2)8-7-22-19(28)10-14-5-4-6-15(9-14)18-11-17-20-16(13-24-27(20)3)12-23-21(17)25-18/h4-6,9,11-13,24H,7-8,10H2,1-3H3,(H,22,28) |
| InChIKey | AXVDYJHIWMGLHG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |