C11H23NO7Si — CID 58383071
methyl 3-[(3-methoxy-3-oxopropyl)-(3-trihydroxysilylpropyl)amino]propanoate (PubChem CID 58383071) has the molecular formula C11H23NO7Si and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 3-[(3-methoxy-3-oxopropyl)-(3-trihydroxysilylpropyl)amino]propanoate.
| Compound Name | methyl 3-[(3-methoxy-3-oxopropyl)-(3-trihydroxysilylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 58383071 |
| Molecular Formula | C11H23NO7Si |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl 3-[(3-methoxy-3-oxopropyl)-(3-trihydroxysilylpropyl)amino]propanoate |
| SMILES | COC(=O)CCN(CCC[Si](O)(O)O)CCC(=O)OC |
| InChI | InChI=1S/C11H23NO7Si/c1-18-10(13)4-7-12(8-5-11(14)19-2)6-3-9-20(15,16)17/h15-17H,3-9H2,1-2H3 |
| InChIKey | VXIOUFASJSICEG-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|