C27H41N7O3 — CID 58384354
(2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1S)-1-ethyl-3,4-dihydro-2H-naphthalen-1-yl]pyrrolidine-2-carboxamide (PubChem CID 58384354) has the molecular formula C27H41N7O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is (2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1S)-1-ethyl-3,4-dihydro-2H-naphthalen-1-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1S)-1-ethyl-3,4-dihydro-2H-naphthalen-1-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58384354 |
| Molecular Formula | C27H41N7O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | (2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1S)-1-ethyl-3,4-dihydro-2H-naphthalen-1-yl]pyrrolidine-2-carboxamide |
| SMILES | CC[C@]1(NC(=O)[C@@H]2C[C@H](N=[N+]=[N-])CN2C(=O)[C@@H](NC(=O)[C@H](C)NC)C(C)(C)C)CCCc2ccccc21 |
| InChI | InChI=1S/C27H41N7O3/c1-7-27(14-10-12-18-11-8-9-13-20(18)27)31-24(36)21-15-19(32-33-28)16-34(21)25(37)22(26(3,4)5)30-23(35)17(2)29-6/h8-9,11,13,17,19,21-22,29H,7,10,12,14-16H2,1-6H3,(H,30,35)(H,31,36)/t17-,19-,21-,22+,27-/m0/s1 |
| InChIKey | DXTRZOULGRPMHE-DEWITRGZSA-N |
| XLogP | 3.16 |
| TPSA | 139.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|