C28H25N3O — CID 58384637
1-[(2S)-2-[5-[2-(4-aminophenyl)ethynyl]-3H-indol-2-yl]pyrrolidin-1-yl]-2-phenylethanone (PubChem CID 58384637) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-[(2S)-2-[5-[2-(4-aminophenyl)ethynyl]-3H-indol-2-yl]pyrrolidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[(2S)-2-[5-[2-(4-aminophenyl)ethynyl]-3H-indol-2-yl]pyrrolidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 58384637 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-[(2S)-2-[5-[2-(4-aminophenyl)ethynyl]-3H-indol-2-yl]pyrrolidin-1-yl]-2-phenylethanone |
| SMILES | Nc1ccc(C#Cc2ccc3c(c2)CC([C@@H]2CCCN2C(=O)Cc2ccccc2)=N3)cc1 |
| InChI | InChI=1S/C28H25N3O/c29-24-13-10-20(11-14-24)8-9-22-12-15-25-23(17-22)19-26(30-25)27-7-4-16-31(27)28(32)18-21-5-2-1-3-6-21/h1-3,5-6,10-15,17,27H,4,7,16,18-19,29H2/t27-/m0/s1 |
| InChIKey | JQYRZGBETULIFW-MHZLTWQESA-N |
| XLogP | 4.53 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|