C46H47NO8 — CID 58385648
methyl 2-[[2-[4-[N-[9,9-dimethyl-7-[2-(2-methylprop-2-enoxy)-2-oxoethyl]fluoren-2-yl]-4-[2-(2-methylprop-2-enoxy)-2-oxoethyl]anilino]phenyl]acetyl]oxymethyl]prop-2-enoate (PubChem CID 58385648) has the molecular formula C46H47NO8 and a molecular weight of 741.88 g/mol. Its IUPAC name is methyl 2-[[2-[4-[N-[9,9-dimethyl-7-[2-(2-methylprop-2-enoxy)-2-oxoethyl]fluoren-2-yl]-4-[2-(2-methylprop-2-enoxy)-2-oxoethyl]anilino]phenyl]acetyl]oxymethyl]prop-2-enoate.
| Compound Name | methyl 2-[[2-[4-[N-[9,9-dimethyl-7-[2-(2-methylprop-2-enoxy)-2-oxoethyl]fluoren-2-yl]-4-[2-(2-methylprop-2-enoxy)-2-oxoethyl]anilino]phenyl]acetyl]oxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 58385648 |
| Molecular Formula | C46H47NO8 |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 741.33 |
| IUPAC Name | methyl 2-[[2-[4-[N-[9,9-dimethyl-7-[2-(2-methylprop-2-enoxy)-2-oxoethyl]fluoren-2-yl]-4-[2-(2-methylprop-2-enoxy)-2-oxoethyl]anilino]phenyl]acetyl]oxymethyl]prop-2-enoate |
| SMILES | C=C(C)COC(=O)Cc1ccc(N(c2ccc(CC(=O)OCC(=C)C(=O)OC)cc2)c2ccc3c(c2)C(C)(C)c2cc(CC(=O)OCC(=C)C)ccc2-3)cc1 |
| InChI | InChI=1S/C46H47NO8/c1-29(2)26-53-42(48)22-32-9-14-35(15-10-32)47(36-16-11-33(12-17-36)23-43(49)55-28-31(5)45(51)52-8)37-18-20-39-38-19-13-34(24-44(50)54-27-30(3)4)21-40(38)46(6,7)41(39)25-37/h9-21,25H,1,3,5,22-24,26-28H2,2,4,6-8H3 |
| InChIKey | QBOPCPHATZOOCO-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|