C50H51NO4 — CID 58876595
[3-[[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]methyl]-5-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate (PubChem CID 58876595) has the molecular formula C50H51NO4 and a molecular weight of 729.96 g/mol. Its IUPAC name is [3-[[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]methyl]-5-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]methyl]-5-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58876595 |
| Molecular Formula | C50H51NO4 |
| Molecular Weight | 729.96 g/mol |
| Exact Mass | 729.38 |
| IUPAC Name | [3-[[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]methyl]-5-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CCOC(=O)C(=C)C)Cc1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C50H51NO4/c1-32(2)47(52)54-27-25-35(26-28-55-48(53)33(3)4)29-34-17-19-36(20-18-34)51(37-21-23-41-39-13-9-11-15-43(39)49(5,6)45(41)30-37)38-22-24-42-40-14-10-12-16-44(40)50(7,8)46(42)31-38/h9-24,30-31,35H,1,3,25-29H2,2,4-8H3 |
| InChIKey | FKVMIBPVSSJDGW-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.96 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|