C27H31N7O — CID 58386919
2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile (PubChem CID 58386919) has the molecular formula C27H31N7O and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile.
| Compound Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile |
|---|---|
| PubChem CID | 58386919 |
| Molecular Formula | C27H31N7O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-isocyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile |
| SMILES | [C-]#[N+]N=C1N(C)CC(c2ccc(CC(=O)c3ncc(C#N)[nH]3)c(C3=CCC(C)(C)CC3)c2)CN1C |
| InChI | InChI=1S/C27H31N7O/c1-27(2)10-8-18(9-11-27)23-12-19(21-16-33(4)26(32-29-3)34(5)17-21)6-7-20(23)13-24(35)25-30-15-22(14-28)31-25/h6-8,12,15,21H,9-11,13,16-17H2,1-2,4-5H3,(H,30,31)/b32-26- |
| InChIKey | MYBREPMZAAJCHO-FSRJSHLRSA-N |
| XLogP | 4.45 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|