C21H23N5O3S — CID 58387018
2-[2-(cyclohexen-1-yl)-4-(1,1-dioxo-1,2,6-thiadiazinan-4-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone (PubChem CID 58387018) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)-4-(1,1-dioxo-1,2,6-thiadiazinan-4-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone.
| Compound Name | 2-[2-(cyclohexen-1-yl)-4-(1,1-dioxo-1,2,6-thiadiazinan-4-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 58387018 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)-4-(1,1-dioxo-1,2,6-thiadiazinan-4-yl)phenyl]-1-(5-isocyano-1H-imidazol-2-yl)ethanone |
| SMILES | [C-]#[N+]c1cnc(C(=O)Cc2ccc(C3CNS(=O)(=O)NC3)cc2C2=CCCCC2)[nH]1 |
| InChI | InChI=1S/C21H23N5O3S/c1-22-20-13-23-21(26-20)19(27)10-16-8-7-15(17-11-24-30(28,29)25-12-17)9-18(16)14-5-3-2-4-6-14/h5,7-9,13,17,24-25H,2-4,6,10-12H2,(H,23,26) |
| InChIKey | LATBDQJSTVJEGK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|