C33H30F2N2O5 — CID 58389007
4-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione (PubChem CID 58389007) has the molecular formula C33H30F2N2O5 and a molecular weight of 572.61 g/mol. Its IUPAC name is 4-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione.
| Compound Name | 4-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 58389007 |
| Molecular Formula | C33H30F2N2O5 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 4-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCc4ccc(CN5CCC(c6ccc(F)cc6F)CC5)cc4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C33H30F2N2O5/c34-23-8-10-25(27(35)16-23)22-12-14-36(15-13-22)18-20-4-6-21(7-5-20)19-42-30-3-1-2-26-31(30)33(41)37(32(26)40)28-11-9-24(38)17-29(28)39/h1-8,10,16,22,28H,9,11-15,17-19H2 |
| InChIKey | BCDKJRRYSWMMFH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|