C36H43N5O6S — CID 58389098
4-[3-oxo-7-[[4-[[4-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]piperazin-1-yl]methyl]phenyl]methoxy]-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 58389098) has the molecular formula C36H43N5O6S and a molecular weight of 673.84 g/mol. Its IUPAC name is 4-[3-oxo-7-[[4-[[4-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]piperazin-1-yl]methyl]phenyl]methoxy]-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[3-oxo-7-[[4-[[4-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]piperazin-1-yl]methyl]phenyl]methoxy]-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 58389098 |
| Molecular Formula | C36H43N5O6S |
| Molecular Weight | 673.84 g/mol |
| Exact Mass | 673.29 |
| IUPAC Name | 4-[3-oxo-7-[[4-[[4-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]piperazin-1-yl]methyl]phenyl]methoxy]-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(CN5CCN(C(=O)CCCCC6SCC7NC(=O)NC76)CC5)cc4)cccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C36H43N5O6S/c42-25-12-13-29(30(43)18-25)41-20-27-26(35(41)45)4-3-5-31(27)47-21-24-10-8-23(9-11-24)19-39-14-16-40(17-15-39)33(44)7-2-1-6-32-34-28(22-48-32)37-36(46)38-34/h3-5,8-11,28-29,32,34H,1-2,6-7,12-22H2,(H2,37,38,46) |
| InChIKey | PBHKKKMOMUIXSR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|