C28H26F3N5O5 — CID 58389267
2-(2,4-dioxocyclohexyl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 58389267) has the molecular formula C28H26F3N5O5 and a molecular weight of 569.54 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58389267 |
| Molecular Formula | C28H26F3N5O5 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[2-(trifluoromethyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCc4ccc(CN5CCN6NC(C(F)(F)F)=NC6C5)cc4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C28H26F3N5O5/c29-28(30,31)27-32-23-14-34(10-11-35(23)33-27)13-16-4-6-17(7-5-16)15-41-22-3-1-2-19-24(22)26(40)36(25(19)39)20-9-8-18(37)12-21(20)38/h1-7,20,23H,8-15H2,(H,32,33) |
| InChIKey | GQUKTGAGUUJFTD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|