C9H17NO3S — CID 58391764
1-(trioxidanylsulfanyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 58391764) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-(trioxidanylsulfanyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(trioxidanylsulfanyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 58391764 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-(trioxidanylsulfanyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | OOOSN1CCCC2CCCCC21 |
| InChI | InChI=1S/C9H17NO3S/c11-12-13-14-10-7-3-5-8-4-1-2-6-9(8)10/h8-9,11H,1-7H2 |
| InChIKey | QEHMMMRFMLRCON-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|