C9H17Cl2NSi — CID 173270803
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane (PubChem CID 173270803) has the molecular formula C9H17Cl2NSi and a molecular weight of 238.23 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane |
|---|---|
| PubChem CID | 173270803 |
| Molecular Formula | C9H17Cl2NSi |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane |
| SMILES | Cl[SiH](Cl)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C9H17Cl2NSi/c10-13(11)12-7-3-5-8-4-1-2-6-9(8)12/h8-9,13H,1-7H2 |
| InChIKey | SLGRAIPCJXNSKC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|