C20H38N2O2Si — CID 10959523
bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-dimethoxysilane (PubChem CID 10959523) has the molecular formula C20H38N2O2Si and a molecular weight of 366.62 g/mol. Its IUPAC name is bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-dimethoxysilane.
| Compound Name | bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-dimethoxysilane |
|---|---|
| PubChem CID | 10959523 |
| Molecular Formula | C20H38N2O2Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-dimethoxysilane |
| SMILES | CO[Si](OC)(N1CCCC2CCCCC21)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C20H38N2O2Si/c1-23-25(24-2,21-15-7-11-17-9-3-5-13-19(17)21)22-16-8-12-18-10-4-6-14-20(18)22/h17-20H,3-16H2,1-2H3 |
| InChIKey | UHKARQPOAGNWFE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|