C14H26F3NO2Si — CID 54096657
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(3,3,3-trifluoropropyl)silane (PubChem CID 54096657) has the molecular formula C14H26F3NO2Si and a molecular weight of 325.45 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(3,3,3-trifluoropropyl)silane.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 54096657 |
| Molecular Formula | C14H26F3NO2Si |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(3,3,3-trifluoropropyl)silane |
| SMILES | CO[Si](CCC(F)(F)F)(OC)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C14H26F3NO2Si/c1-19-21(20-2,11-9-14(15,16)17)18-10-5-7-12-6-3-4-8-13(12)18/h12-13H,3-11H2,1-2H3 |
| InChIKey | MXOPVIHVSGNVNN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|