C24H44N2O2Si — CID 140844211
bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-(methoxymethyl)-(oxolan-2-yl)silane (PubChem CID 140844211) has the molecular formula C24H44N2O2Si and a molecular weight of 420.71 g/mol. Its IUPAC name is bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-(methoxymethyl)-(oxolan-2-yl)silane.
| Compound Name | bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-(methoxymethyl)-(oxolan-2-yl)silane |
|---|---|
| PubChem CID | 140844211 |
| Molecular Formula | C24H44N2O2Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-(methoxymethyl)-(oxolan-2-yl)silane |
| SMILES | COC[Si](C1CCCO1)(N1CCCC2CCCCC21)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C24H44N2O2Si/c1-27-19-29(24-15-8-18-28-24,25-16-6-11-20-9-2-4-13-22(20)25)26-17-7-12-21-10-3-5-14-23(21)26/h20-24H,2-19H2,1H3 |
| InChIKey | ABWBLYRUFCWOGX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|