C21H40N2O2Si — CID 141083178
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane (PubChem CID 141083178) has the molecular formula C21H40N2O2Si and a molecular weight of 380.65 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane |
|---|---|
| PubChem CID | 141083178 |
| Molecular Formula | C21H40N2O2Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-dimethoxy-(5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane |
| SMILES | CO[Si](OC)(N1CCCC2CCCCC21)N1CCCC2C(C)CCCC21 |
| InChI | InChI=1S/C21H40N2O2Si/c1-17-9-6-14-21-19(17)12-8-16-23(21)26(24-2,25-3)22-15-7-11-18-10-4-5-13-20(18)22/h17-21H,4-16H2,1-3H3 |
| InChIKey | YZPOCFYAKXQYLQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|