C22H24Cl2N2O4S — CID 58393849
(3R)-1-[(1S,2S)-4,6-dichloro-1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol (PubChem CID 58393849) has the molecular formula C22H24Cl2N2O4S and a molecular weight of 483.42 g/mol. Its IUPAC name is (3R)-1-[(1S,2S)-4,6-dichloro-1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(1S,2S)-4,6-dichloro-1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 58393849 |
| Molecular Formula | C22H24Cl2N2O4S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (3R)-1-[(1S,2S)-4,6-dichloro-1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol |
| SMILES | O=S1(=O)CCCN1c1cccc(O[C@H]2c3cc(Cl)cc(Cl)c3C[C@@H]2N2CC[C@@H](O)C2)c1 |
| InChI | InChI=1S/C22H24Cl2N2O4S/c23-14-9-19-18(20(24)10-14)12-21(25-7-5-16(27)13-25)22(19)30-17-4-1-3-15(11-17)26-6-2-8-31(26,28)29/h1,3-4,9-11,16,21-22,27H,2,5-8,12-13H2/t16-,21+,22+/m1/s1 |
| InChIKey | YOTPJHAOCOHHIW-XGRCMKMKSA-N |
| XLogP | 3.64 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |