C24H23Cl3N2O5 — CID 58394184
3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethyl-1,3-oxazolidine-2,4-dione (PubChem CID 58394184) has the molecular formula C24H23Cl3N2O5 and a molecular weight of 525.82 g/mol. Its IUPAC name is 3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 58394184 |
| Molecular Formula | C24H23Cl3N2O5 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethyl-1,3-oxazolidine-2,4-dione |
| SMILES | CC1(C)OC(=O)N(c2ccc(Cl)c(O[C@H]3c4cc(Cl)cc(Cl)c4C[C@@H]3N3CC[C@@H](O)C3)c2)C1=O |
| InChI | InChI=1S/C24H23Cl3N2O5/c1-24(2)22(31)29(23(32)34-24)13-3-4-17(26)20(9-13)33-21-16-7-12(25)8-18(27)15(16)10-19(21)28-6-5-14(30)11-28/h3-4,7-9,14,19,21,30H,5-6,10-11H2,1-2H3/t14-,19+,21+/m1/s1 |
| InChIKey | LVQQHNPIWFZYFO-RFVSGWPVSA-N |
| XLogP | 5.02 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |