C24H24Cl3N3O4 — CID 67310481
3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 67310481) has the molecular formula C24H24Cl3N3O4 and a molecular weight of 524.83 g/mol. Its IUPAC name is 3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67310481 |
| Molecular Formula | C24H24Cl3N3O4 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 3-[4-chloro-3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccc(Cl)c(O[C@H]3c4cc(Cl)cc(Cl)c4C[C@@H]3N3CC[C@@H](O)C3)c2)C1=O |
| InChI | InChI=1S/C24H24Cl3N3O4/c1-24(2)22(32)30(23(33)28-24)13-3-4-17(26)20(9-13)34-21-16-7-12(25)8-18(27)15(16)10-19(21)29-6-5-14(31)11-29/h3-4,7-9,14,19,21,31H,5-6,10-11H2,1-2H3,(H,28,33)/t14-,19+,21+/m1/s1 |
| InChIKey | ZWTKOJGIJJISOL-RFVSGWPVSA-N |
| XLogP | 4.59 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|