C11H22FN — CID 58394716
(3R,4S)-4-tert-butyl-1-ethyl-3-fluoropiperidine (PubChem CID 58394716) has the molecular formula C11H22FN and a molecular weight of 187.30 g/mol. Its IUPAC name is (3R,4S)-4-tert-butyl-1-ethyl-3-fluoropiperidine.
| Compound Name | (3R,4S)-4-tert-butyl-1-ethyl-3-fluoropiperidine |
|---|---|
| PubChem CID | 58394716 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | (3R,4S)-4-tert-butyl-1-ethyl-3-fluoropiperidine |
| SMILES | CCN1CC[C@@H](C(C)(C)C)[C@@H](F)C1 |
| InChI | InChI=1S/C11H22FN/c1-5-13-7-6-9(10(12)8-13)11(2,3)4/h9-10H,5-8H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | UKYDFIXTBUSAMR-ZJUUUORDSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |