C18H21N7O2S — CID 58395359
3-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58395359) has the molecular formula C18H21N7O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58395359 |
| Molecular Formula | C18H21N7O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-[1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | Cc1nc(S(=O)(=O)N2CCC(n3cnc4cnc5[nH]ccc5c43)CC2)cn1C |
| InChI | InChI=1S/C18H21N7O2S/c1-12-22-16(10-23(12)2)28(26,27)24-7-4-13(5-8-24)25-11-21-15-9-20-18-14(17(15)25)3-6-19-18/h3,6,9-11,13H,4-5,7-8H2,1-2H3,(H,19,20) |
| InChIKey | WGJDETMNTMYPNG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |