C26H29N5OSi — CID 58395951
4-[2-(3H-isoindol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyridin-2-amine (PubChem CID 58395951) has the molecular formula C26H29N5OSi and a molecular weight of 455.64 g/mol. Its IUPAC name is 4-[2-(3H-isoindol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyridin-2-amine.
| Compound Name | 4-[2-(3H-isoindol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58395951 |
| Molecular Formula | C26H29N5OSi |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-[2-(3H-isoindol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]pyridin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc3c(c2)CN=C3)cc2c(-c3ccnc(N)c3)ccnc21 |
| InChI | InChI=1S/C26H29N5OSi/c1-33(2,3)11-10-32-17-31-24(19-4-5-20-15-28-16-21(20)12-19)14-23-22(7-9-30-26(23)31)18-6-8-29-25(27)13-18/h4-9,12-15H,10-11,16-17H2,1-3H3,(H2,27,29) |
| InChIKey | KLRGPAFGUPIDAD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|