C29H28N2O6S — CID 58399710
[4-(2-aminoethoxy)phenyl]-[4-[4-[4-(2-aminoethoxy)phenyl]sulfonylphenoxy]phenyl]methanone (PubChem CID 58399710) has the molecular formula C29H28N2O6S and a molecular weight of 532.62 g/mol. Its IUPAC name is [4-(2-aminoethoxy)phenyl]-[4-[4-[4-(2-aminoethoxy)phenyl]sulfonylphenoxy]phenyl]methanone.
| Compound Name | [4-(2-aminoethoxy)phenyl]-[4-[4-[4-(2-aminoethoxy)phenyl]sulfonylphenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 58399710 |
| Molecular Formula | C29H28N2O6S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | [4-(2-aminoethoxy)phenyl]-[4-[4-[4-(2-aminoethoxy)phenyl]sulfonylphenoxy]phenyl]methanone |
| SMILES | NCCOc1ccc(C(=O)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(OCCN)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O6S/c30-17-19-35-23-5-1-21(2-6-23)29(32)22-3-7-25(8-4-22)37-26-11-15-28(16-12-26)38(33,34)27-13-9-24(10-14-27)36-20-18-31/h1-16H,17-20,30-31H2 |
| InChIKey | YGYPFTLFNUGALL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |