C52H37N4OP — CID 58399820
1,3-bis(3,5-diphenylphenyl)-2-(2-phenylpyrimidin-5-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 58399820) has the molecular formula C52H37N4OP and a molecular weight of 764.87 g/mol. Its IUPAC name is 1,3-bis(3,5-diphenylphenyl)-2-(2-phenylpyrimidin-5-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 1,3-bis(3,5-diphenylphenyl)-2-(2-phenylpyrimidin-5-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 58399820 |
| Molecular Formula | C52H37N4OP |
| Molecular Weight | 764.87 g/mol |
| Exact Mass | 764.27 |
| IUPAC Name | 1,3-bis(3,5-diphenylphenyl)-2-(2-phenylpyrimidin-5-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | O=P1(c2cnc(-c3ccccc3)nc2)N(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2ccccc2N1c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C52H37N4OP/c57-58(49-36-53-52(54-37-49)42-26-14-5-15-27-42)55(47-32-43(38-18-6-1-7-19-38)30-44(33-47)39-20-8-2-9-21-39)50-28-16-17-29-51(50)56(58)48-34-45(40-22-10-3-11-23-40)31-46(35-48)41-24-12-4-13-25-41/h1-37H |
| InChIKey | XRMUWJCBIKRKIG-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.87 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|