C48H33N8OP — CID 58400018
1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 58400018) has the molecular formula C48H33N8OP and a molecular weight of 768.82 g/mol. Its IUPAC name is 1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 58400018 |
| Molecular Formula | C48H33N8OP |
| Molecular Weight | 768.82 g/mol |
| Exact Mass | 768.25 |
| IUPAC Name | 1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | O=P1(c2ccc(-c3ccccc3)cc2)N(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c2ccccc2N1c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C48H33N8OP/c57-58(40-32-30-35(31-33-40)34-18-6-1-7-19-34)55(47-51-43(36-20-8-2-9-21-36)49-44(52-47)37-22-10-3-11-23-37)41-28-16-17-29-42(41)56(58)48-53-45(38-24-12-4-13-25-38)50-46(54-48)39-26-14-5-15-27-39/h1-33H |
| InChIKey | GUTGZPHCDHNVAH-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 100.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.82 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|