C57H40N5OP — CID 58399883
1,3-bis(3,4-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 58399883) has the molecular formula C57H40N5OP and a molecular weight of 841.96 g/mol. Its IUPAC name is 1,3-bis(3,4-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 1,3-bis(3,4-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 58399883 |
| Molecular Formula | C57H40N5OP |
| Molecular Weight | 841.96 g/mol |
| Exact Mass | 841.30 |
| IUPAC Name | 1,3-bis(3,4-diphenylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | O=P1(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)N(c2ccc(-c3ccccc3)c(-c3ccccc3)c2)c2ccccc2N1c1ccc(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C57H40N5OP/c63-64(57-59-55(45-29-15-5-16-30-45)58-56(60-57)46-31-17-6-18-32-46)61(47-35-37-49(41-21-7-1-8-22-41)51(39-47)43-25-11-3-12-26-43)53-33-19-20-34-54(53)62(64)48-36-38-50(42-23-9-2-10-24-42)52(40-48)44-27-13-4-14-28-44/h1-40H |
| InChIKey | HVBPXFWMKXZYPE-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.96 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|