C45H31N4O2P — CID 162698926
6-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,5,10-triphenylbenzo[c][5,2,1]benzoxazaphosphepine 6-oxide (PubChem CID 162698926) has the molecular formula C45H31N4O2P and a molecular weight of 690.74 g/mol. Its IUPAC name is 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,5,10-triphenylbenzo[c][5,2,1]benzoxazaphosphepine 6-oxide.
| Compound Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,5,10-triphenylbenzo[c][5,2,1]benzoxazaphosphepine 6-oxide |
|---|---|
| PubChem CID | 162698926 |
| Molecular Formula | C45H31N4O2P |
| Molecular Weight | 690.74 g/mol |
| Exact Mass | 690.22 |
| IUPAC Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,5,10-triphenylbenzo[c][5,2,1]benzoxazaphosphepine 6-oxide |
| SMILES | O=P1(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c2cccc(-c3ccccc3)c2Oc2c(-c3ccccc3)cccc2N1c1ccccc1 |
| InChI | InChI=1S/C45H31N4O2P/c50-52(45-47-43(34-22-10-3-11-23-34)46-44(48-45)35-24-12-4-13-25-35)40-31-17-29-38(33-20-8-2-9-21-33)42(40)51-41-37(32-18-6-1-7-19-32)28-16-30-39(41)49(52)36-26-14-5-15-27-36/h1-31H |
| InChIKey | NQIOFKORZQICBC-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.74 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|