C19H16F6IrNO5- — CID 58401707
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;[2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;iridium (PubChem CID 58401707) has the molecular formula C19H16F6IrNO5- and a molecular weight of 644.54 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;[2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;iridium.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;[2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;iridium |
|---|---|
| PubChem CID | 58401707 |
| Molecular Formula | C19H16F6IrNO5- |
| Molecular Weight | 644.54 g/mol |
| Exact Mass | 645.06 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;[2-[2-(hydroxymethyl)-4-methoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;iridium |
| SMILES | COc1c[c-]c(-c2cc(CO)ccn2)c(CO)c1.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C14H14NO3.C5H2F6O2.Ir/c1-18-12-2-3-13(11(7-12)9-17)14-6-10(8-16)4-5-15-14;6-4(7,8)2(12)1-3(13)5(9,10)11;/h2,4-7,16-17H,8-9H2,1H3;1,12H;/q-1;;/b;2-1-; |
| InChIKey | HHHHDSYNCVAJIM-FJOGWHKWSA-N |
| XLogP | 3.66 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|