C32H32N2O4PtS2 — CID 58401839
2-(2,4-diethoxybenzene-6-id-1-yl)-4-methylsulfanylpyridine;[2-(4-ethoxy-2-ethynoxybenzene-6-id-1-yl)-4-pyridinyl]methanethiol;platinum(2+) (PubChem CID 58401839) has the molecular formula C32H32N2O4PtS2 and a molecular weight of 767.83 g/mol. Its IUPAC name is 2-(2,4-diethoxybenzene-6-id-1-yl)-4-methylsulfanylpyridine;[2-(4-ethoxy-2-ethynoxybenzene-6-id-1-yl)-4-pyridinyl]methanethiol;platinum(2+).
| Compound Name | 2-(2,4-diethoxybenzene-6-id-1-yl)-4-methylsulfanylpyridine;[2-(4-ethoxy-2-ethynoxybenzene-6-id-1-yl)-4-pyridinyl]methanethiol;platinum(2+) |
|---|---|
| PubChem CID | 58401839 |
| Molecular Formula | C32H32N2O4PtS2 |
| Molecular Weight | 767.83 g/mol |
| Exact Mass | 767.15 |
| IUPAC Name | 2-(2,4-diethoxybenzene-6-id-1-yl)-4-methylsulfanylpyridine;[2-(4-ethoxy-2-ethynoxybenzene-6-id-1-yl)-4-pyridinyl]methanethiol;platinum(2+) |
| SMILES | C#COc1cc(OCC)c[c-]c1-c1cc(CS)ccn1.CCOc1c[c-]c(-c2cc(SC)ccn2)c(OCC)c1.[Pt+2] |
| InChI | InChI=1S/C16H18NO2S.C16H14NO2S.Pt/c1-4-18-12-6-7-14(16(10-12)19-5-2)15-11-13(20-3)8-9-17-15;1-3-18-13-5-6-14(16(10-13)19-4-2)15-9-12(11-20)7-8-17-15;/h6,8-11H,4-5H2,1-3H3;2,5,7-10,20H,3,11H2,1H3;/q2*-1;+2 |
| InChIKey | FAZNVNYQJRJUFM-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.83 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|