C21H26ClNO4S2 — CID 123906294
1-(2-chloro-4-pyridinyl)-3-sulfanylpropan-2-one;1-(2,5-diethoxyphenyl)-3-sulfanylpropan-2-one (PubChem CID 123906294) has the molecular formula C21H26ClNO4S2 and a molecular weight of 456.03 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-3-sulfanylpropan-2-one;1-(2,5-diethoxyphenyl)-3-sulfanylpropan-2-one.
| Compound Name | 1-(2-chloro-4-pyridinyl)-3-sulfanylpropan-2-one;1-(2,5-diethoxyphenyl)-3-sulfanylpropan-2-one |
|---|---|
| PubChem CID | 123906294 |
| Molecular Formula | C21H26ClNO4S2 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-3-sulfanylpropan-2-one;1-(2,5-diethoxyphenyl)-3-sulfanylpropan-2-one |
| SMILES | CCOc1ccc(OCC)c(CC(=O)CS)c1.O=C(CS)Cc1ccnc(Cl)c1 |
| InChI | InChI=1S/C13H18O3S.C8H8ClNOS/c1-3-15-12-5-6-13(16-4-2)10(8-12)7-11(14)9-17;9-8-4-6(1-2-10-8)3-7(11)5-12/h5-6,8,17H,3-4,7,9H2,1-2H3;1-2,4,12H,3,5H2 |
| InChIKey | DYTNHZJOTQBHOR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|